C27H32N8O4 — CID 153399490
tert-butyl 4-[4-[[3-(3,4-dimethoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]phenyl]piperazine-1-carboxylate (PubChem CID 153399490) has the molecular formula C27H32N8O4 and a molecular weight of 532.61 g/mol. Its IUPAC name is tert-butyl 4-[4-[[3-(3,4-dimethoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[3-(3,4-dimethoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 153399490 |
| Molecular Formula | C27H32N8O4 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | tert-butyl 4-[4-[[3-(3,4-dimethoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]phenyl]piperazine-1-carboxylate |
| SMILES | COc1ccc(-n2nnc3cnc(Nc4ccc(N5CCN(C(=O)OC(C)(C)C)CC5)cc4)nc32)cc1OC |
| InChI | InChI=1S/C27H32N8O4/c1-27(2,3)39-26(36)34-14-12-33(13-15-34)19-8-6-18(7-9-19)29-25-28-17-21-24(30-25)35(32-31-21)20-10-11-22(37-4)23(16-20)38-5/h6-11,16-17H,12-15H2,1-5H3,(H,28,29,30) |
| InChIKey | JKNJVKCKZSNIRB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 119.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|