C25H26F3N5O4 — CID 171779424
tert-butyl 4-[4-[[6-nitro-4-(trifluoromethyl)quinolin-2-yl]amino]phenyl]piperazine-1-carboxylate (PubChem CID 171779424) has the molecular formula C25H26F3N5O4 and a molecular weight of 517.51 g/mol. Its IUPAC name is tert-butyl 4-[4-[[6-nitro-4-(trifluoromethyl)quinolin-2-yl]amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[6-nitro-4-(trifluoromethyl)quinolin-2-yl]amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171779424 |
| Molecular Formula | C25H26F3N5O4 |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | tert-butyl 4-[4-[[6-nitro-4-(trifluoromethyl)quinolin-2-yl]amino]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(Nc3cc(C(F)(F)F)c4cc([N+](=O)[O-])ccc4n3)cc2)CC1 |
| InChI | InChI=1S/C25H26F3N5O4/c1-24(2,3)37-23(34)32-12-10-31(11-13-32)17-6-4-16(5-7-17)29-22-15-20(25(26,27)28)19-14-18(33(35)36)8-9-21(19)30-22/h4-9,14-15H,10-13H2,1-3H3,(H,29,30) |
| InChIKey | OZAIRLJAOWCDQK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|