C30H29F3N6O3 — CID 86675721
tert-butyl 4-[4-[[4-[2-(3-oxo-1,2-dihydroisoindol-4-yl)ethynyl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate (PubChem CID 86675721) has the molecular formula C30H29F3N6O3 and a molecular weight of 578.60 g/mol. Its IUPAC name is tert-butyl 4-[4-[[4-[2-(3-oxo-1,2-dihydroisoindol-4-yl)ethynyl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[4-[2-(3-oxo-1,2-dihydroisoindol-4-yl)ethynyl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86675721 |
| Molecular Formula | C30H29F3N6O3 |
| Molecular Weight | 578.60 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | tert-butyl 4-[4-[[4-[2-(3-oxo-1,2-dihydroisoindol-4-yl)ethynyl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(Nc3ncc(C(F)(F)F)c(C#Cc4cccc5c4C(=O)NC5)n3)cc2)CC1 |
| InChI | InChI=1S/C30H29F3N6O3/c1-29(2,3)42-28(41)39-15-13-38(14-16-39)22-10-8-21(9-11-22)36-27-35-18-23(30(31,32)33)24(37-27)12-7-19-5-4-6-20-17-34-26(40)25(19)20/h4-6,8-11,18H,13-17H2,1-3H3,(H,34,40)(H,35,36,37) |
| InChIKey | BEJHXGAKGDIBIM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|