C32H42N6O2 — CID 70991580
tert-butyl 4-[4-[[4-(N-cyclohexylanilino)-5-methylpyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate (PubChem CID 70991580) has the molecular formula C32H42N6O2 and a molecular weight of 542.73 g/mol. Its IUPAC name is tert-butyl 4-[4-[[4-(N-cyclohexylanilino)-5-methylpyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[4-(N-cyclohexylanilino)-5-methylpyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 70991580 |
| Molecular Formula | C32H42N6O2 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | tert-butyl 4-[4-[[4-(N-cyclohexylanilino)-5-methylpyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate |
| SMILES | Cc1cnc(Nc2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc2)nc1N(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C32H42N6O2/c1-24-23-33-30(35-29(24)38(27-11-7-5-8-12-27)28-13-9-6-10-14-28)34-25-15-17-26(18-16-25)36-19-21-37(22-20-36)31(39)40-32(2,3)4/h5,7-8,11-12,15-18,23,28H,6,9-10,13-14,19-22H2,1-4H3,(H,33,34,35) |
| InChIKey | LCLGDXJCYFTUIA-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|