C27H34BBrN6O — CID 58299586
[4-[4-[[5-bromo-4-(N-cyclohexylanilino)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]-methylborinic acid (PubChem CID 58299586) has the molecular formula C27H34BBrN6O and a molecular weight of 549.33 g/mol. Its IUPAC name is [4-[4-[[5-bromo-4-(N-cyclohexylanilino)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]-methylborinic acid.
| Compound Name | [4-[4-[[5-bromo-4-(N-cyclohexylanilino)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 58299586 |
| Molecular Formula | C27H34BBrN6O |
| Molecular Weight | 549.33 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | [4-[4-[[5-bromo-4-(N-cyclohexylanilino)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCN(c2ccc(Nc3ncc(Br)c(N(c4ccccc4)C4CCCCC4)n3)cc2)CC1 |
| InChI | InChI=1S/C27H34BBrN6O/c1-28(36)34-18-16-33(17-19-34)22-14-12-21(13-15-22)31-27-30-20-25(29)26(32-27)35(23-8-4-2-5-9-23)24-10-6-3-7-11-24/h2,4-5,8-9,12-15,20,24,36H,3,6-7,10-11,16-19H2,1H3,(H,30,31,32) |
| InChIKey | WBBXWYWPNWRRLV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.33 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|