C18H23N7 — CID 171729690
N-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-1H-pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 171729690) has the molecular formula C18H23N7 and a molecular weight of 337.43 g/mol. Its IUPAC name is N-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-1H-pyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | N-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-1H-pyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 171729690 |
| Molecular Formula | C18H23N7 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | N-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-1H-pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | CN(C)C1CCN(c2ccc(Nc3ncc4cn[nH]c4n3)cc2)CC1 |
| InChI | InChI=1S/C18H23N7/c1-24(2)15-7-9-25(10-8-15)16-5-3-14(4-6-16)21-18-19-11-13-12-20-23-17(13)22-18/h3-6,11-12,15H,7-10H2,1-2H3,(H2,19,20,21,22,23) |
| InChIKey | LRYJTUOTJXFVFD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|