C26H34BrN7OS — CID 144643432
3-[[5-bromo-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]pyrimidin-4-yl]amino]-1-(3-methylsulfanylpropyl)pyridin-2-one (PubChem CID 144643432) has the molecular formula C26H34BrN7OS and a molecular weight of 572.58 g/mol. Its IUPAC name is 3-[[5-bromo-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]pyrimidin-4-yl]amino]-1-(3-methylsulfanylpropyl)pyridin-2-one.
| Compound Name | 3-[[5-bromo-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]pyrimidin-4-yl]amino]-1-(3-methylsulfanylpropyl)pyridin-2-one |
|---|---|
| PubChem CID | 144643432 |
| Molecular Formula | C26H34BrN7OS |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | 3-[[5-bromo-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]pyrimidin-4-yl]amino]-1-(3-methylsulfanylpropyl)pyridin-2-one |
| SMILES | CSCCCn1cccc(Nc2nc(Nc3ccc(N4CCC(N(C)C)CC4)cc3)ncc2Br)c1=O |
| InChI | InChI=1S/C26H34BrN7OS/c1-32(2)20-11-15-33(16-12-20)21-9-7-19(8-10-21)29-26-28-18-22(27)24(31-26)30-23-6-4-13-34(25(23)35)14-5-17-36-3/h4,6-10,13,18,20H,5,11-12,14-17H2,1-3H3,(H2,28,29,30,31) |
| InChIKey | XDHGRTIADNFZMR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|