C30H36N8O2 — CID 155132115
(12Z)-5-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-16-hydroxy-16-methyl-2,4,6,10,21-pentazatetracyclo[15.3.1.02,10.03,8]henicosa-1(20),3,5,7,12,17(21),18-heptaen-9-one (PubChem CID 155132115) has the molecular formula C30H36N8O2 and a molecular weight of 540.67 g/mol. Its IUPAC name is (12Z)-5-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-16-hydroxy-16-methyl-2,4,6,10,21-pentazatetracyclo[15.3.1.02,10.03,8]henicosa-1(20),3,5,7,12,17(21),18-heptaen-9-one.
| Compound Name | (12Z)-5-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-16-hydroxy-16-methyl-2,4,6,10,21-pentazatetracyclo[15.3.1.02,10.03,8]henicosa-1(20),3,5,7,12,17(21),18-heptaen-9-one |
|---|---|
| PubChem CID | 155132115 |
| Molecular Formula | C30H36N8O2 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | (12Z)-5-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-16-hydroxy-16-methyl-2,4,6,10,21-pentazatetracyclo[15.3.1.02,10.03,8]henicosa-1(20),3,5,7,12,17(21),18-heptaen-9-one |
| SMILES | CN(C)C1CCN(c2ccc(Nc3ncc4c(=O)n5n(c4n3)-c3cccc(n3)C(C)(O)CC/C=C\C5)cc2)CC1 |
| InChI | InChI=1S/C30H36N8O2/c1-30(40)16-5-4-6-17-37-28(39)24-20-31-29(34-27(24)38(37)26-9-7-8-25(30)33-26)32-21-10-12-23(13-11-21)36-18-14-22(15-19-36)35(2)3/h4,6-13,20,22,40H,5,14-19H2,1-3H3,(H,31,32,34)/b6-4- |
| InChIKey | ICTJIQJIICEJGK-XQRVVYSFSA-N |
| XLogP | 3.81 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|