C30H33N9O3 — CID 155363391
(12E)-5-[4-(4-methylpiperazin-1-yl)anilino]-21-oxa-2,4,6,10,18,25-hexazapentacyclo[16.6.2.02,10.03,8.022,26]hexacosa-1(25),3,5,7,12,22(26),23-heptaene-9,19-dione (PubChem CID 155363391) has the molecular formula C30H33N9O3 and a molecular weight of 567.65 g/mol. Its IUPAC name is (12E)-5-[4-(4-methylpiperazin-1-yl)anilino]-21-oxa-2,4,6,10,18,25-hexazapentacyclo[16.6.2.02,10.03,8.022,26]hexacosa-1(25),3,5,7,12,22(26),23-heptaene-9,19-dione.
| Compound Name | (12E)-5-[4-(4-methylpiperazin-1-yl)anilino]-21-oxa-2,4,6,10,18,25-hexazapentacyclo[16.6.2.02,10.03,8.022,26]hexacosa-1(25),3,5,7,12,22(26),23-heptaene-9,19-dione |
|---|---|
| PubChem CID | 155363391 |
| Molecular Formula | C30H33N9O3 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | (12E)-5-[4-(4-methylpiperazin-1-yl)anilino]-21-oxa-2,4,6,10,18,25-hexazapentacyclo[16.6.2.02,10.03,8.022,26]hexacosa-1(25),3,5,7,12,22(26),23-heptaene-9,19-dione |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(=O)n5n(c4n3)-c3ccc4c(n3)N(CCCC/C=C/C5)C(=O)CO4)cc2)CC1 |
| InChI | InChI=1S/C30H33N9O3/c1-35-15-17-36(18-16-35)22-9-7-21(8-10-22)32-30-31-19-23-27(34-30)39-25-12-11-24-28(33-25)37(26(40)20-42-24)13-5-3-2-4-6-14-38(39)29(23)41/h4,6-12,19H,2-3,5,13-18,20H2,1H3,(H,31,32,34)/b6-4+ |
| InChIKey | ZKGQUYMYEXQPIM-GQCTYLIASA-N |
| XLogP | 2.94 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|