C29H29N9O3 — CID 146338432
5-[4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,21(25),22-hexaen-12-yne-9,18-dione (PubChem CID 146338432) has the molecular formula C29H29N9O3 and a molecular weight of 551.61 g/mol. Its IUPAC name is 5-[4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,21(25),22-hexaen-12-yne-9,18-dione.
| Compound Name | 5-[4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,21(25),22-hexaen-12-yne-9,18-dione |
|---|---|
| PubChem CID | 146338432 |
| Molecular Formula | C29H29N9O3 |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | 5-[4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,21(25),22-hexaen-12-yne-9,18-dione |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(=O)n5n(c4n3)-c3ccc4c(n3)N(CCCC#CC5)C(=O)CO4)cc2)CC1 |
| InChI | InChI=1S/C29H29N9O3/c1-34-14-16-35(17-15-34)21-8-6-20(7-9-21)31-29-30-18-22-26(33-29)38-24-11-10-23-27(32-24)36(25(39)19-41-23)12-4-2-3-5-13-37(38)28(22)40/h6-11,18H,2,4,12-17,19H2,1H3,(H,30,31,33) |
| InChIKey | XEYHLWUYXOTJJR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|