C31H35N9O3 — CID 155363437
(12Z)-15,15-dimethyl-5-[4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione (PubChem CID 155363437) has the molecular formula C31H35N9O3 and a molecular weight of 581.68 g/mol. Its IUPAC name is (12Z)-15,15-dimethyl-5-[4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione.
| Compound Name | (12Z)-15,15-dimethyl-5-[4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
|---|---|
| PubChem CID | 155363437 |
| Molecular Formula | C31H35N9O3 |
| Molecular Weight | 581.68 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | (12Z)-15,15-dimethyl-5-[4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(=O)n5n(c4n3)-c3ccc4c(n3)N(CC(C)(C)C/C=C/C5)C(=O)CO4)cc2)CC1 |
| InChI | InChI=1S/C31H35N9O3/c1-31(2)12-4-5-13-39-29(42)23-18-32-30(33-21-6-8-22(9-7-21)37-16-14-36(3)15-17-37)35-27(23)40(39)25-11-10-24-28(34-25)38(20-31)26(41)19-43-24/h4-11,18H,12-17,19-20H2,1-3H3,(H,32,33,35)/b5-4+ |
| InChIKey | DPGRNKNYEZWYEU-SNAWJCMRSA-N |
| XLogP | 3.18 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.68 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|