C28H32N8O2 — CID 146338278
(12E)-5-[4-(4-methylpiperazin-1-yl)anilino]-18-oxa-2,4,6,10,23-pentazatetracyclo[17.3.1.02,10.03,8]tricosa-1(23),3,5,7,12,19,21-heptaen-9-one (PubChem CID 146338278) has the molecular formula C28H32N8O2 and a molecular weight of 512.62 g/mol. Its IUPAC name is (12E)-5-[4-(4-methylpiperazin-1-yl)anilino]-18-oxa-2,4,6,10,23-pentazatetracyclo[17.3.1.02,10.03,8]tricosa-1(23),3,5,7,12,19,21-heptaen-9-one.
| Compound Name | (12E)-5-[4-(4-methylpiperazin-1-yl)anilino]-18-oxa-2,4,6,10,23-pentazatetracyclo[17.3.1.02,10.03,8]tricosa-1(23),3,5,7,12,19,21-heptaen-9-one |
|---|---|
| PubChem CID | 146338278 |
| Molecular Formula | C28H32N8O2 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | (12E)-5-[4-(4-methylpiperazin-1-yl)anilino]-18-oxa-2,4,6,10,23-pentazatetracyclo[17.3.1.02,10.03,8]tricosa-1(23),3,5,7,12,19,21-heptaen-9-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(=O)n5n(c4n3)-c3cccc(n3)OCCCC/C=C/C5)cc2)CC1 |
| InChI | InChI=1S/C28H32N8O2/c1-33-15-17-34(18-16-33)22-12-10-21(11-13-22)30-28-29-20-23-26(32-28)36-24-8-7-9-25(31-24)38-19-6-4-2-3-5-14-35(36)27(23)37/h3,5,7-13,20H,2,4,6,14-19H2,1H3,(H,29,30,32)/b5-3+ |
| InChIKey | YUPPNZCCWVCDSV-HWKANZROSA-N |
| XLogP | 3.59 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|