C31H36N8O3 — CID 146338324
(12Z)-5-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17-pentazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaen-9-one (PubChem CID 146338324) has the molecular formula C31H36N8O3 and a molecular weight of 568.68 g/mol. Its IUPAC name is (12Z)-5-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17-pentazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaen-9-one.
| Compound Name | (12Z)-5-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17-pentazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaen-9-one |
|---|---|
| PubChem CID | 146338324 |
| Molecular Formula | C31H36N8O3 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | (12Z)-5-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17-pentazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaen-9-one |
| SMILES | COc1cc(Nc2ncc3c(=O)n4n(c3n2)-c2ccc3c(c2)N(CCC/C=C/C4)CCO3)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C31H36N8O3/c1-35-13-15-37(16-14-35)25-9-7-22(19-28(25)41-2)33-31-32-21-24-29(34-31)39-23-8-10-27-26(20-23)36(17-18-42-27)11-5-3-4-6-12-38(39)30(24)40/h4,6-10,19-21H,3,5,11-18H2,1-2H3,(H,32,33,34)/b6-4+ |
| InChIKey | ULFCXKYAPVBEQT-GQCTYLIASA-N |
| XLogP | 3.63 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|