C30H33N9O4 — CID 159391254
5-[3-methoxy-5-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,22-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione (PubChem CID 159391254) has the molecular formula C30H33N9O4 and a molecular weight of 583.65 g/mol. Its IUPAC name is 5-[3-methoxy-5-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,22-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione.
| Compound Name | 5-[3-methoxy-5-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,22-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
|---|---|
| PubChem CID | 159391254 |
| Molecular Formula | C30H33N9O4 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | 5-[3-methoxy-5-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,22-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
| SMILES | COc1cc(Nc2ncc3c(=O)n4n(c3n2)-c2cnc3c(c2)N(CCCC=CC4)C(=O)CO3)cc(N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C30H33N9O4/c1-35-9-11-36(12-10-35)21-13-20(14-23(15-21)42-2)33-30-32-18-24-27(34-30)39-22-16-25-28(31-17-22)43-19-26(40)37(25)7-5-3-4-6-8-38(39)29(24)41/h4,6,13-18H,3,5,7-12,19H2,1-2H3,(H,32,33,34) |
| InChIKey | XGEVQAYFWBWWOH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|