C30H32N8O3 — CID 146338357
(12Z)-5-[(1,1,2-trimethyl-3,4-dihydroisoquinolin-7-yl)amino]-20-oxa-2,4,6,10,17,22-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione (PubChem CID 146338357) has the molecular formula C30H32N8O3 and a molecular weight of 552.64 g/mol. Its IUPAC name is (12Z)-5-[(1,1,2-trimethyl-3,4-dihydroisoquinolin-7-yl)amino]-20-oxa-2,4,6,10,17,22-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione.
| Compound Name | (12Z)-5-[(1,1,2-trimethyl-3,4-dihydroisoquinolin-7-yl)amino]-20-oxa-2,4,6,10,17,22-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
|---|---|
| PubChem CID | 146338357 |
| Molecular Formula | C30H32N8O3 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | (12Z)-5-[(1,1,2-trimethyl-3,4-dihydroisoquinolin-7-yl)amino]-20-oxa-2,4,6,10,17,22-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
| SMILES | CN1CCc2ccc(Nc3ncc4c(=O)n5n(c4n3)-c3cnc4c(c3)N(CCC/C=C\C5)C(=O)CO4)cc2C1(C)C |
| InChI | InChI=1S/C30H32N8O3/c1-30(2)23-14-20(9-8-19(23)10-13-35(30)3)33-29-32-17-22-26(34-29)38-21-15-24-27(31-16-21)41-18-25(39)36(24)11-6-4-5-7-12-37(38)28(22)40/h5,7-9,14-17H,4,6,10-13,18H2,1-3H3,(H,32,33,34)/b7-5- |
| InChIKey | SHJQGQAOVTWHLR-ALCCZGGFSA-N |
| XLogP | 3.52 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|