C31H34N8O3 — CID 146338284
(12Z)-5-[4-(3,4-dimethylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17-pentazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione (PubChem CID 146338284) has the molecular formula C31H34N8O3 and a molecular weight of 566.67 g/mol. Its IUPAC name is (12Z)-5-[4-(3,4-dimethylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17-pentazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione.
| Compound Name | (12Z)-5-[4-(3,4-dimethylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17-pentazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
|---|---|
| PubChem CID | 146338284 |
| Molecular Formula | C31H34N8O3 |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | (12Z)-5-[4-(3,4-dimethylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17-pentazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
| SMILES | CC1CN(c2ccc(Nc3ncc4c(=O)n5n(c4n3)-c3ccc4c(c3)N(CCC/C=C/C5)C(=O)CO4)cc2)CCN1C |
| InChI | InChI=1S/C31H34N8O3/c1-21-19-36(16-15-35(21)2)23-9-7-22(8-10-23)33-31-32-18-25-29(34-31)39-24-11-12-27-26(17-24)37(28(40)20-42-27)13-5-3-4-6-14-38(39)30(25)41/h4,6-12,17-18,21H,3,5,13-16,19-20H2,1-2H3,(H,32,33,34)/b6-4+ |
| InChIKey | DTTWUHXUCCBBIV-GQCTYLIASA-N |
| XLogP | 3.54 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|