C30H32N8O4 — CID 158992676
15-hydroxy-5-[(1,1,2-trimethyl-3,4-dihydroisoquinolin-7-yl)amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione (PubChem CID 158992676) has the molecular formula C30H32N8O4 and a molecular weight of 568.64 g/mol. Its IUPAC name is 15-hydroxy-5-[(1,1,2-trimethyl-3,4-dihydroisoquinolin-7-yl)amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione.
| Compound Name | 15-hydroxy-5-[(1,1,2-trimethyl-3,4-dihydroisoquinolin-7-yl)amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
|---|---|
| PubChem CID | 158992676 |
| Molecular Formula | C30H32N8O4 |
| Molecular Weight | 568.64 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | 15-hydroxy-5-[(1,1,2-trimethyl-3,4-dihydroisoquinolin-7-yl)amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
| SMILES | CN1CCc2ccc(Nc3ncc4c(=O)n5n(c4n3)-c3ccc4c(n3)N(CC(O)CC=CC5)C(=O)CO4)cc2C1(C)C |
| InChI | InChI=1S/C30H32N8O4/c1-30(2)22-14-19(8-7-18(22)11-13-35(30)3)32-29-31-15-21-26(34-29)38-24-10-9-23-27(33-24)36(25(40)17-42-23)16-20(39)6-4-5-12-37(38)28(21)41/h4-5,7-10,14-15,20,39H,6,11-13,16-17H2,1-3H3,(H,31,32,34) |
| InChIKey | SMRGLZBAWQUELC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.64 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|