C31H34N8O3 — CID 155644464
(12E)-18,18-dimethyl-5-[(2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)amino]-19-oxa-2,4,6,10,16,23-hexazapentacyclo[14.6.2.02,10.03,8.020,24]tetracosa-1(23),3,5,7,12,20(24),21-heptaene-9,17-dione (PubChem CID 155644464) has the molecular formula C31H34N8O3 and a molecular weight of 566.67 g/mol. Its IUPAC name is (12E)-18,18-dimethyl-5-[(2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)amino]-19-oxa-2,4,6,10,16,23-hexazapentacyclo[14.6.2.02,10.03,8.020,24]tetracosa-1(23),3,5,7,12,20(24),21-heptaene-9,17-dione.
| Compound Name | (12E)-18,18-dimethyl-5-[(2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)amino]-19-oxa-2,4,6,10,16,23-hexazapentacyclo[14.6.2.02,10.03,8.020,24]tetracosa-1(23),3,5,7,12,20(24),21-heptaene-9,17-dione |
|---|---|
| PubChem CID | 155644464 |
| Molecular Formula | C31H34N8O3 |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | (12E)-18,18-dimethyl-5-[(2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)amino]-19-oxa-2,4,6,10,16,23-hexazapentacyclo[14.6.2.02,10.03,8.020,24]tetracosa-1(23),3,5,7,12,20(24),21-heptaene-9,17-dione |
| SMILES | CN1Cc2cc(Nc3ncc4c(=O)n5n(c4n3)-c3ccc4c(n3)N(CC/C=C\C5)C(=O)C(C)(C)O4)ccc2C(C)(C)C1 |
| InChI | InChI=1S/C31H34N8O3/c1-30(2)18-36(5)17-19-15-20(9-10-22(19)30)33-29-32-16-21-25(35-29)39-24-12-11-23-26(34-24)37(28(41)31(3,4)42-23)13-7-6-8-14-38(39)27(21)40/h6,8-12,15-16H,7,13-14,17-18H2,1-5H3,(H,32,33,35)/b8-6- |
| InChIKey | GRJCGAIAPPTYRD-VURMDHGXSA-N |
| XLogP | 3.91 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|