C28H26N8O5 — CID 162240525
methyl 6-[(9,17-dioxo-19-oxa-2,4,6,10,16,23-hexazapentacyclo[14.6.2.02,10.03,8.020,24]tetracosa-1(23),3,5,7,12,20(24),21-heptaen-5-yl)amino]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 162240525) has the molecular formula C28H26N8O5 and a molecular weight of 554.57 g/mol. Its IUPAC name is methyl 6-[(9,17-dioxo-19-oxa-2,4,6,10,16,23-hexazapentacyclo[14.6.2.02,10.03,8.020,24]tetracosa-1(23),3,5,7,12,20(24),21-heptaen-5-yl)amino]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | methyl 6-[(9,17-dioxo-19-oxa-2,4,6,10,16,23-hexazapentacyclo[14.6.2.02,10.03,8.020,24]tetracosa-1(23),3,5,7,12,20(24),21-heptaen-5-yl)amino]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 162240525 |
| Molecular Formula | C28H26N8O5 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | methyl 6-[(9,17-dioxo-19-oxa-2,4,6,10,16,23-hexazapentacyclo[14.6.2.02,10.03,8.020,24]tetracosa-1(23),3,5,7,12,20(24),21-heptaen-5-yl)amino]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | COC(=O)N1CCc2cc(Nc3ncc4c(=O)n5n(c4n3)-c3ccc4c(n3)N(CCC=CC5)C(=O)CO4)ccc2C1 |
| InChI | InChI=1S/C28H26N8O5/c1-40-28(39)33-12-9-17-13-19(6-5-18(17)15-33)30-27-29-14-20-24(32-27)36-22-8-7-21-25(31-22)34(23(37)16-41-21)10-3-2-4-11-35(36)26(20)38/h2,4-8,13-14H,3,9-12,15-16H2,1H3,(H,29,30,32) |
| InChIKey | ALIHHUQYAMEXMU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|