C30H31N9O3 — CID 146338421
(12Z)-5-[[1-[2-(dimethylamino)ethyl]indol-5-yl]amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione (PubChem CID 146338421) has the molecular formula C30H31N9O3 and a molecular weight of 565.64 g/mol. Its IUPAC name is (12Z)-5-[[1-[2-(dimethylamino)ethyl]indol-5-yl]amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione.
| Compound Name | (12Z)-5-[[1-[2-(dimethylamino)ethyl]indol-5-yl]amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
|---|---|
| PubChem CID | 146338421 |
| Molecular Formula | C30H31N9O3 |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | (12Z)-5-[[1-[2-(dimethylamino)ethyl]indol-5-yl]amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
| SMILES | CN(C)CCn1ccc2cc(Nc3ncc4c(=O)n5n(c4n3)-c3ccc4c(n3)N(CCC/C=C\C5)C(=O)CO4)ccc21 |
| InChI | InChI=1S/C30H31N9O3/c1-35(2)15-16-36-14-11-20-17-21(7-8-23(20)36)32-30-31-18-22-27(34-30)39-25-10-9-24-28(33-25)37(26(40)19-42-24)12-5-3-4-6-13-38(39)29(22)41/h4,6-11,14,17-18H,3,5,12-13,15-16,19H2,1-2H3,(H,31,32,34)/b6-4- |
| InChIKey | NLXPXYGELKMPQJ-XQRVVYSFSA-N |
| XLogP | 3.31 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|