C31H36N8O2 — CID 159940044
5-[[1-[2-(dimethylamino)ethyl]indol-5-yl]amino]-18,18-dimethyl-17-oxa-2,4,6,10,23-pentazatetracyclo[17.3.1.02,10.03,8]tricosa-1(22),3,5,7,12,19(23),20-heptaen-9-one (PubChem CID 159940044) has the molecular formula C31H36N8O2 and a molecular weight of 552.68 g/mol. Its IUPAC name is 5-[[1-[2-(dimethylamino)ethyl]indol-5-yl]amino]-18,18-dimethyl-17-oxa-2,4,6,10,23-pentazatetracyclo[17.3.1.02,10.03,8]tricosa-1(22),3,5,7,12,19(23),20-heptaen-9-one.
| Compound Name | 5-[[1-[2-(dimethylamino)ethyl]indol-5-yl]amino]-18,18-dimethyl-17-oxa-2,4,6,10,23-pentazatetracyclo[17.3.1.02,10.03,8]tricosa-1(22),3,5,7,12,19(23),20-heptaen-9-one |
|---|---|
| PubChem CID | 159940044 |
| Molecular Formula | C31H36N8O2 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | 5-[[1-[2-(dimethylamino)ethyl]indol-5-yl]amino]-18,18-dimethyl-17-oxa-2,4,6,10,23-pentazatetracyclo[17.3.1.02,10.03,8]tricosa-1(22),3,5,7,12,19(23),20-heptaen-9-one |
| SMILES | CN(C)CCn1ccc2cc(Nc3ncc4c(=O)n5n(c4n3)-c3cccc(n3)C(C)(C)OCCCC=CC5)ccc21 |
| InChI | InChI=1S/C31H36N8O2/c1-31(2)26-10-9-11-27(34-26)39-28-24(29(40)38(39)15-7-5-6-8-19-41-31)21-32-30(35-28)33-23-12-13-25-22(20-23)14-16-37(25)18-17-36(3)4/h5,7,9-14,16,20-21H,6,8,15,17-19H2,1-4H3,(H,32,33,35) |
| InChIKey | IZVVHHYCXFUZLS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 95.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|