C33H40N8O2 — CID 155132076
(12Z,16S)-16-hydroxy-16-methyl-5-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2,4,6,10,21-pentazatetracyclo[15.3.1.02,10.03,8]henicosa-1(20),3,5,7,12,17(21),18-heptaen-9-one (PubChem CID 155132076) has the molecular formula C33H40N8O2 and a molecular weight of 580.74 g/mol. Its IUPAC name is (12Z,16S)-16-hydroxy-16-methyl-5-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2,4,6,10,21-pentazatetracyclo[15.3.1.02,10.03,8]henicosa-1(20),3,5,7,12,17(21),18-heptaen-9-one.
| Compound Name | (12Z,16S)-16-hydroxy-16-methyl-5-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2,4,6,10,21-pentazatetracyclo[15.3.1.02,10.03,8]henicosa-1(20),3,5,7,12,17(21),18-heptaen-9-one |
|---|---|
| PubChem CID | 155132076 |
| Molecular Formula | C33H40N8O2 |
| Molecular Weight | 580.74 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | (12Z,16S)-16-hydroxy-16-methyl-5-[4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)anilino]-2,4,6,10,21-pentazatetracyclo[15.3.1.02,10.03,8]henicosa-1(20),3,5,7,12,17(21),18-heptaen-9-one |
| SMILES | CN1CCC2(CC1)CCN(c1ccc(Nc3ncc4c(=O)n5n(c4n3)-c3cccc(n3)[C@@](C)(O)CC/C=C\C5)cc1)CC2 |
| InChI | InChI=1S/C33H40N8O2/c1-32(43)13-4-3-5-18-40-30(42)26-23-34-31(37-29(26)41(40)28-8-6-7-27(32)36-28)35-24-9-11-25(12-10-24)39-21-16-33(17-22-39)14-19-38(2)20-15-33/h3,5-12,23,43H,4,13-22H2,1-2H3,(H,34,35,37)/b5-3-/t32-/m0/s1 |
| InChIKey | BHUFHKQBPGIDKP-RFGIXMQASA-N |
| XLogP | 4.59 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.74 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|