C33H37N7O2 — CID 161401241
5-[[1-(1-propan-2-ylpiperidin-4-yl)indol-5-yl]amino]-17-oxa-2,4,6,10-tetrazatetracyclo[16.3.1.02,10.03,8]docosa-1(22),3,5,7,12,18,20-heptaen-9-one (PubChem CID 161401241) has the molecular formula C33H37N7O2 and a molecular weight of 563.71 g/mol. Its IUPAC name is 5-[[1-(1-propan-2-ylpiperidin-4-yl)indol-5-yl]amino]-17-oxa-2,4,6,10-tetrazatetracyclo[16.3.1.02,10.03,8]docosa-1(22),3,5,7,12,18,20-heptaen-9-one.
| Compound Name | 5-[[1-(1-propan-2-ylpiperidin-4-yl)indol-5-yl]amino]-17-oxa-2,4,6,10-tetrazatetracyclo[16.3.1.02,10.03,8]docosa-1(22),3,5,7,12,18,20-heptaen-9-one |
|---|---|
| PubChem CID | 161401241 |
| Molecular Formula | C33H37N7O2 |
| Molecular Weight | 563.71 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | 5-[[1-(1-propan-2-ylpiperidin-4-yl)indol-5-yl]amino]-17-oxa-2,4,6,10-tetrazatetracyclo[16.3.1.02,10.03,8]docosa-1(22),3,5,7,12,18,20-heptaen-9-one |
| SMILES | CC(C)N1CCC(n2ccc3cc(Nc4ncc5c(=O)n6n(c5n4)-c4cccc(c4)OCCCC=CC6)ccc32)CC1 |
| InChI | InChI=1S/C33H37N7O2/c1-23(2)37-16-13-26(14-17-37)38-18-12-24-20-25(10-11-30(24)38)35-33-34-22-29-31(36-33)40-27-8-7-9-28(21-27)42-19-6-4-3-5-15-39(40)32(29)41/h3,5,7-12,18,20-23,26H,4,6,13-17,19H2,1-2H3,(H,34,35,36) |
| InChIKey | JRXFRJZIZIPPRB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 82.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.71 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|