C32H33N9O3 — CID 155363508
(12Z)-5-[[1-[[1-(dimethylamino)cyclopropyl]methyl]indol-5-yl]amino]-20-oxa-2,4,6,10,17,22-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione (PubChem CID 155363508) has the molecular formula C32H33N9O3 and a molecular weight of 591.68 g/mol. Its IUPAC name is (12Z)-5-[[1-[[1-(dimethylamino)cyclopropyl]methyl]indol-5-yl]amino]-20-oxa-2,4,6,10,17,22-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione.
| Compound Name | (12Z)-5-[[1-[[1-(dimethylamino)cyclopropyl]methyl]indol-5-yl]amino]-20-oxa-2,4,6,10,17,22-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
|---|---|
| PubChem CID | 155363508 |
| Molecular Formula | C32H33N9O3 |
| Molecular Weight | 591.68 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | (12Z)-5-[[1-[[1-(dimethylamino)cyclopropyl]methyl]indol-5-yl]amino]-20-oxa-2,4,6,10,17,22-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
| SMILES | CN(C)C1(Cn2ccc3cc(Nc4ncc5c(=O)n6n(c5n4)-c4cnc5c(c4)N(CCC/C=C\C6)C(=O)CO5)ccc32)CC1 |
| InChI | InChI=1S/C32H33N9O3/c1-37(2)32(10-11-32)20-38-14-9-21-15-22(7-8-25(21)38)35-31-34-18-24-28(36-31)41-23-16-26-29(33-17-23)44-19-27(42)39(26)12-5-3-4-6-13-40(41)30(24)43/h4,6-9,14-18H,3,5,10-13,19-20H2,1-2H3,(H,34,35,36)/b6-4- |
| InChIKey | YBDGHEZEGFVWHJ-XQRVVYSFSA-N |
| XLogP | 3.85 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.68 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|