C30H35N9O3 — CID 146338514
(12Z)-5-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaen-9-one (PubChem CID 146338514) has the molecular formula C30H35N9O3 and a molecular weight of 569.67 g/mol. Its IUPAC name is (12Z)-5-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaen-9-one.
| Compound Name | (12Z)-5-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaen-9-one |
|---|---|
| PubChem CID | 146338514 |
| Molecular Formula | C30H35N9O3 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | (12Z)-5-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaen-9-one |
| SMILES | COc1cc(Nc2ncc3c(=O)n4n(c3n2)-c2ccc3c(n2)N(CCC/C=C/C4)CCO3)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C30H35N9O3/c1-35-13-15-36(16-14-35)23-8-7-21(19-25(23)41-2)32-30-31-20-22-27(34-30)39-26-10-9-24-28(33-26)37(17-18-42-24)11-5-3-4-6-12-38(39)29(22)40/h4,6-10,19-20H,3,5,11-18H2,1-2H3,(H,31,32,34)/b6-4+ |
| InChIKey | GOOOTVXTKPMDJD-GQCTYLIASA-N |
| XLogP | 3.03 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|