C29H30N8O3 — CID 158549304
5-[(2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)amino]-19-oxa-2,4,6,10,16,23-hexazapentacyclo[14.6.2.02,10.03,8.020,24]tetracosa-1(23),3,5,7,12,20(24),21-heptaene-9,17-dione (PubChem CID 158549304) has the molecular formula C29H30N8O3 and a molecular weight of 538.61 g/mol. Its IUPAC name is 5-[(2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)amino]-19-oxa-2,4,6,10,16,23-hexazapentacyclo[14.6.2.02,10.03,8.020,24]tetracosa-1(23),3,5,7,12,20(24),21-heptaene-9,17-dione.
| Compound Name | 5-[(2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)amino]-19-oxa-2,4,6,10,16,23-hexazapentacyclo[14.6.2.02,10.03,8.020,24]tetracosa-1(23),3,5,7,12,20(24),21-heptaene-9,17-dione |
|---|---|
| PubChem CID | 158549304 |
| Molecular Formula | C29H30N8O3 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 5-[(2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)amino]-19-oxa-2,4,6,10,16,23-hexazapentacyclo[14.6.2.02,10.03,8.020,24]tetracosa-1(23),3,5,7,12,20(24),21-heptaene-9,17-dione |
| SMILES | CN1Cc2cc(Nc3ncc4c(=O)n5n(c4n3)-c3ccc4c(n3)N(CCC=CC5)C(=O)CO4)ccc2C(C)(C)C1 |
| InChI | InChI=1S/C29H30N8O3/c1-29(2)17-34(3)15-18-13-19(7-8-21(18)29)31-28-30-14-20-25(33-28)37-23-10-9-22-26(32-23)35(24(38)16-40-22)11-5-4-6-12-36(37)27(20)39/h4,6-10,13-14H,5,11-12,15-17H2,1-3H3,(H,30,31,33) |
| InChIKey | OWVKQQPKFMZQSR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|