C31H33N7O2 — CID 166970409
(12Z)-18-hydroxy-5-[(2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-7-yl)amino]-2,4,6,10,17-pentazapentacyclo[15.5.2.02,10.03,8.020,24]tetracosa-1(23),3,5,7,12,20(24),21-heptaen-9-one (PubChem CID 166970409) has the molecular formula C31H33N7O2 and a molecular weight of 535.65 g/mol. Its IUPAC name is (12Z)-18-hydroxy-5-[(2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-7-yl)amino]-2,4,6,10,17-pentazapentacyclo[15.5.2.02,10.03,8.020,24]tetracosa-1(23),3,5,7,12,20(24),21-heptaen-9-one.
| Compound Name | (12Z)-18-hydroxy-5-[(2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-7-yl)amino]-2,4,6,10,17-pentazapentacyclo[15.5.2.02,10.03,8.020,24]tetracosa-1(23),3,5,7,12,20(24),21-heptaen-9-one |
|---|---|
| PubChem CID | 166970409 |
| Molecular Formula | C31H33N7O2 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | (12Z)-18-hydroxy-5-[(2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-7-yl)amino]-2,4,6,10,17-pentazapentacyclo[15.5.2.02,10.03,8.020,24]tetracosa-1(23),3,5,7,12,20(24),21-heptaen-9-one |
| SMILES | CN1Cc2cc(Nc3ncc4c(=O)n5n(c4n3)-c3ccc4c(c3)N(CCC/C=C\C5)C(O)C4)ccc2C2(CC2)C1 |
| InChI | InChI=1S/C31H33N7O2/c1-35-18-21-14-22(7-9-25(21)31(19-35)10-11-31)33-30-32-17-24-28(34-30)38-23-8-6-20-15-27(39)36(26(20)16-23)12-4-2-3-5-13-37(38)29(24)40/h3,5-9,14,16-17,27,39H,2,4,10-13,15,18-19H2,1H3,(H,32,33,34)/b5-3- |
| InChIKey | QVYVFAXAWGTMSA-HYXAFXHYSA-N |
| XLogP | 3.83 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|