C27H25N7O3 — CID 159005518
5-[(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)amino]-18-oxa-2,4,6,10,16-pentazapentacyclo[14.5.2.02,10.03,8.019,23]tricosa-1(22),3,5,7,12,19(23),20-heptaene-9,17-dione (PubChem CID 159005518) has the molecular formula C27H25N7O3 and a molecular weight of 495.54 g/mol. Its IUPAC name is 5-[(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)amino]-18-oxa-2,4,6,10,16-pentazapentacyclo[14.5.2.02,10.03,8.019,23]tricosa-1(22),3,5,7,12,19(23),20-heptaene-9,17-dione.
| Compound Name | 5-[(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)amino]-18-oxa-2,4,6,10,16-pentazapentacyclo[14.5.2.02,10.03,8.019,23]tricosa-1(22),3,5,7,12,19(23),20-heptaene-9,17-dione |
|---|---|
| PubChem CID | 159005518 |
| Molecular Formula | C27H25N7O3 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 5-[(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)amino]-18-oxa-2,4,6,10,16-pentazapentacyclo[14.5.2.02,10.03,8.019,23]tricosa-1(22),3,5,7,12,19(23),20-heptaene-9,17-dione |
| SMILES | CN1CCc2ccc(Nc3ncc4c(=O)n5n(c4n3)-c3ccc4oc(=O)n(c4c3)CCC=CC5)cc2C1 |
| InChI | InChI=1S/C27H25N7O3/c1-31-12-9-17-5-6-19(13-18(17)16-31)29-26-28-15-21-24(30-26)34-20-7-8-23-22(14-20)32(27(36)37-23)10-3-2-4-11-33(34)25(21)35/h2,4-8,13-15H,3,9-12,16H2,1H3,(H,28,29,30) |
| InChIKey | FBWUGCLIHZGHFC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|