C25H33N7 — CID 58015942
7-butan-2-yl-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-5-methylpyrrolo[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 58015942) has the molecular formula C25H33N7 and a molecular weight of 431.59 g/mol. Its IUPAC name is 7-butan-2-yl-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-5-methylpyrrolo[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | 7-butan-2-yl-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-5-methylpyrrolo[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 58015942 |
| Molecular Formula | C25H33N7 |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | 7-butan-2-yl-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-5-methylpyrrolo[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | CCC(C)n1c(C#N)c(C)c2cnc(Nc3ccc(N4CCC(N(C)C)CC4)cc3)nc21 |
| InChI | InChI=1S/C25H33N7/c1-6-17(2)32-23(15-26)18(3)22-16-27-25(29-24(22)32)28-19-7-9-21(10-8-19)31-13-11-20(12-14-31)30(4)5/h7-10,16-17,20H,6,11-14H2,1-5H3,(H,27,28,29) |
| InChIKey | CWUZBDOBOMWKFO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 73.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|