C24H30N8 — CID 58300079
8-[(2S)-butan-2-yl]-N-[5-[4-(methylamino)piperidin-1-yl]-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58300079) has the molecular formula C24H30N8 and a molecular weight of 430.56 g/mol. Its IUPAC name is 8-[(2S)-butan-2-yl]-N-[5-[4-(methylamino)piperidin-1-yl]-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | 8-[(2S)-butan-2-yl]-N-[5-[4-(methylamino)piperidin-1-yl]-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58300079 |
| Molecular Formula | C24H30N8 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 8-[(2S)-butan-2-yl]-N-[5-[4-(methylamino)piperidin-1-yl]-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | CC[C@H](C)n1c2cnccc2c2cnc(Nc3ccc(N4CCC(NC)CC4)cn3)nc21 |
| InChI | InChI=1S/C24H30N8/c1-4-16(2)32-21-15-26-10-7-19(21)20-14-28-24(30-23(20)32)29-22-6-5-18(13-27-22)31-11-8-17(25-3)9-12-31/h5-7,10,13-17,25H,4,8-9,11-12H2,1-3H3,(H,27,28,29,30)/t16-/m0/s1 |
| InChIKey | QIQHZHDHJRCDDH-INIZCTEOSA-N |
| XLogP | 4.28 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |