C27H35N9 — CID 58299725
8-cyclopentyl-N-[6-[4-(diethylamino)piperidin-1-yl]pyridazin-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58299725) has the molecular formula C27H35N9 and a molecular weight of 485.64 g/mol. Its IUPAC name is 8-cyclopentyl-N-[6-[4-(diethylamino)piperidin-1-yl]pyridazin-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | 8-cyclopentyl-N-[6-[4-(diethylamino)piperidin-1-yl]pyridazin-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58299725 |
| Molecular Formula | C27H35N9 |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 8-cyclopentyl-N-[6-[4-(diethylamino)piperidin-1-yl]pyridazin-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | CCN(CC)C1CCN(c2ccc(Nc3ncc4c5ccncc5n(C5CCCC5)c4n3)nn2)CC1 |
| InChI | InChI=1S/C27H35N9/c1-3-34(4-2)19-12-15-35(16-13-19)25-10-9-24(32-33-25)30-27-29-17-22-21-11-14-28-18-23(21)36(26(22)31-27)20-7-5-6-8-20/h9-11,14,17-20H,3-8,12-13,15-16H2,1-2H3,(H,29,30,31,32) |
| InChIKey | NOUVQMCOTSOPTN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |