C22H25N9O — CID 58300014
cis-(1R,2S)-2-[5-[(6-piperazin-1-ylpyridazin-3-yl)amino]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl]cyclopentan-1-ol (PubChem CID 58300014) has the molecular formula C22H25N9O and a molecular weight of 431.50 g/mol. Its IUPAC name is cis-(1R,2S)-2-[5-[(6-piperazin-1-ylpyridazin-3-yl)amino]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl]cyclopentan-1-ol.
| Compound Name | cis-(1R,2S)-2-[5-[(6-piperazin-1-ylpyridazin-3-yl)amino]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 58300014 |
| Molecular Formula | C22H25N9O |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | cis-(1R,2S)-2-[5-[(6-piperazin-1-ylpyridazin-3-yl)amino]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl]cyclopentan-1-ol |
| SMILES | O[C@@H]1CCC[C@@H]1n1c2cnccc2c2cnc(Nc3ccc(N4CCNCC4)nn3)nc21 |
| InChI | InChI=1S/C22H25N9O/c32-18-3-1-2-16(18)31-17-13-24-7-6-14(17)15-12-25-22(27-21(15)31)26-19-4-5-20(29-28-19)30-10-8-23-9-11-30/h4-7,12-13,16,18,23,32H,1-3,8-11H2,(H,25,26,27,28)/t16-,18+/m0/s1 |
| InChIKey | AEULBWHWKNPNIM-FUHWJXTLSA-N |
| XLogP | 2.01 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |