C26H33N9 — CID 143829618
8-cyclohexyl-N-[6-[4-(dimethylamino)piperidin-1-yl]pyridazin-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 143829618) has the molecular formula C26H33N9 and a molecular weight of 471.61 g/mol. Its IUPAC name is 8-cyclohexyl-N-[6-[4-(dimethylamino)piperidin-1-yl]pyridazin-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | 8-cyclohexyl-N-[6-[4-(dimethylamino)piperidin-1-yl]pyridazin-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 143829618 |
| Molecular Formula | C26H33N9 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | 8-cyclohexyl-N-[6-[4-(dimethylamino)piperidin-1-yl]pyridazin-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | CN(C)C1CCN(c2ccc(Nc3ncc4c5ccncc5n(C5CCCCC5)c4n3)nn2)CC1 |
| InChI | InChI=1S/C26H33N9/c1-33(2)18-11-14-34(15-12-18)24-9-8-23(31-32-24)29-26-28-16-21-20-10-13-27-17-22(20)35(25(21)30-26)19-6-4-3-5-7-19/h8-10,13,16-19H,3-7,11-12,14-15H2,1-2H3,(H,28,29,30,31) |
| InChIKey | XBWFQLRLDVRMNW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |