C21H24N8O — CID 58299839
2-[[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-methylamino]ethanol (PubChem CID 58299839) has the molecular formula C21H24N8O and a molecular weight of 404.48 g/mol. Its IUPAC name is 2-[[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-methylamino]ethanol.
| Compound Name | 2-[[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-methylamino]ethanol |
|---|---|
| PubChem CID | 58299839 |
| Molecular Formula | C21H24N8O |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-[[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-methylamino]ethanol |
| SMILES | CN(CCO)c1ccc(Nc2ncc3c4ccncc4n(C4CCCC4)c3n2)nn1 |
| InChI | InChI=1S/C21H24N8O/c1-28(10-11-30)19-7-6-18(26-27-19)24-21-23-12-16-15-8-9-22-13-17(15)29(20(16)25-21)14-4-2-3-5-14/h6-9,12-14,30H,2-5,10-11H2,1H3,(H,23,24,25,26) |
| InChIKey | HFYYJLJETVWZJA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |