C28H34N8O — CID 70991601
(3R)-1-[1-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperidin-4-yl]pyrrolidin-3-ol (PubChem CID 70991601) has the molecular formula C28H34N8O and a molecular weight of 498.64 g/mol. Its IUPAC name is (3R)-1-[1-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperidin-4-yl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[1-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperidin-4-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 70991601 |
| Molecular Formula | C28H34N8O |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | (3R)-1-[1-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperidin-4-yl]pyrrolidin-3-ol |
| SMILES | O[C@@H]1CCN(C2CCN(c3ccc(Nc4ncc5c6ccncc6n(C6CCCC6)c5n4)nc3)CC2)C1 |
| InChI | InChI=1S/C28H34N8O/c37-22-10-14-35(18-22)19-8-12-34(13-9-19)21-5-6-26(30-15-21)32-28-31-16-24-23-7-11-29-17-25(23)36(27(24)33-28)20-3-1-2-4-20/h5-7,11,15-17,19-20,22,37H,1-4,8-10,12-14,18H2,(H,30,31,32,33)/t22-/m1/s1 |
| InChIKey | DEXZHKNXZYDRKP-JOCHJYFZSA-N |
| XLogP | 4.27 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |