C23H29N5 — CID 58015910
7-cyclopentyl-5-methyl-N-(4-piperidin-1-ylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 58015910) has the molecular formula C23H29N5 and a molecular weight of 375.52 g/mol. Its IUPAC name is 7-cyclopentyl-5-methyl-N-(4-piperidin-1-ylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-cyclopentyl-5-methyl-N-(4-piperidin-1-ylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 58015910 |
| Molecular Formula | C23H29N5 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 7-cyclopentyl-5-methyl-N-(4-piperidin-1-ylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | Cc1cn(C2CCCC2)c2nc(Nc3ccc(N4CCCCC4)cc3)ncc12 |
| InChI | InChI=1S/C23H29N5/c1-17-16-28(20-7-3-4-8-20)22-21(17)15-24-23(26-22)25-18-9-11-19(12-10-18)27-13-5-2-6-14-27/h9-12,15-16,20H,2-8,13-14H2,1H3,(H,24,25,26) |
| InChIKey | DAXWWXZQZRXZDQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|