C23H31N7O2S — CID 24959348
1-cycloheptyl-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 24959348) has the molecular formula C23H31N7O2S and a molecular weight of 469.62 g/mol. Its IUPAC name is 1-cycloheptyl-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | 1-cycloheptyl-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 24959348 |
| Molecular Formula | C23H31N7O2S |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 1-cycloheptyl-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(Nc3ncc4cnn(C5CCCCCC5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C23H31N7O2S/c1-33(31,32)29-14-12-28(13-15-29)20-10-8-19(9-11-20)26-23-24-16-18-17-25-30(22(18)27-23)21-6-4-2-3-5-7-21/h8-11,16-17,21H,2-7,12-15H2,1H3,(H,24,26,27) |
| InChIKey | VQQWSSDIJAORSU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|