C30H33ClN6O3S — CID 53253064
6-(4-chlorophenyl)sulfonyl-8-cyclohexyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 53253064) has the molecular formula C30H33ClN6O3S and a molecular weight of 593.15 g/mol. Its IUPAC name is 6-(4-chlorophenyl)sulfonyl-8-cyclohexyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(4-chlorophenyl)sulfonyl-8-cyclohexyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 53253064 |
| Molecular Formula | C30H33ClN6O3S |
| Molecular Weight | 593.15 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | 6-(4-chlorophenyl)sulfonyl-8-cyclohexyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4cc(S(=O)(=O)c5ccc(Cl)cc5)c(=O)n(C5CCCCC5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C30H33ClN6O3S/c1-35-15-17-36(18-16-35)24-11-9-23(10-12-24)33-30-32-20-21-19-27(41(39,40)26-13-7-22(31)8-14-26)29(38)37(28(21)34-30)25-5-3-2-4-6-25/h7-14,19-20,25H,2-6,15-18H2,1H3,(H,32,33,34) |
| InChIKey | YDVJMPKDDFLLMP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.15 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|