C33H31ClN6O2 — CID 54760180
6-(2-chlorophenyl)-8-(3,4-dihydro-2H-chromen-3-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 54760180) has the molecular formula C33H31ClN6O2 and a molecular weight of 579.10 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-8-(3,4-dihydro-2H-chromen-3-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2-chlorophenyl)-8-(3,4-dihydro-2H-chromen-3-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 54760180 |
| Molecular Formula | C33H31ClN6O2 |
| Molecular Weight | 579.10 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | 6-(2-chlorophenyl)-8-(3,4-dihydro-2H-chromen-3-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4cc(-c5ccccc5Cl)c(=O)n(C5COc6ccccc6C5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C33H31ClN6O2/c1-38-14-16-39(17-15-38)25-12-10-24(11-13-25)36-33-35-20-23-19-28(27-7-3-4-8-29(27)34)32(41)40(31(23)37-33)26-18-22-6-2-5-9-30(22)42-21-26/h2-13,19-20,26H,14-18,21H2,1H3,(H,35,36,37) |
| InChIKey | ZTTSOGYLOHDDPH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.10 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|