C20H15ClN4O — CID 141354763
2-anilino-6-(2-chlorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 141354763) has the molecular formula C20H15ClN4O and a molecular weight of 362.82 g/mol. Its IUPAC name is 2-anilino-6-(2-chlorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-anilino-6-(2-chlorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 141354763 |
| Molecular Formula | C20H15ClN4O |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 2-anilino-6-(2-chlorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cn1c(=O)c(-c2ccccc2Cl)cc2cnc(Nc3ccccc3)nc21 |
| InChI | InChI=1S/C20H15ClN4O/c1-25-18-13(11-16(19(25)26)15-9-5-6-10-17(15)21)12-22-20(24-18)23-14-7-3-2-4-8-14/h2-12H,1H3,(H,22,23,24) |
| InChIKey | RWXABUYRLOYAON-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |