C19H21ClN4OS — CID 163954555
6-(2-chlorophenyl)-2-(3-ethylsulfanylpropylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 163954555) has the molecular formula C19H21ClN4OS and a molecular weight of 388.92 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-2-(3-ethylsulfanylpropylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2-chlorophenyl)-2-(3-ethylsulfanylpropylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 163954555 |
| Molecular Formula | C19H21ClN4OS |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 6-(2-chlorophenyl)-2-(3-ethylsulfanylpropylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCSCCCNc1ncc2cc(-c3ccccc3Cl)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C19H21ClN4OS/c1-3-26-10-6-9-21-19-22-12-13-11-15(14-7-4-5-8-16(14)20)18(25)24(2)17(13)23-19/h4-5,7-8,11-12H,3,6,9-10H2,1-2H3,(H,21,22,23) |
| InChIKey | SCFGFVMPVIRTLL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|