C20H21ClN4O2 — CID 91429644
2-[[6-(2-chlorophenyl)-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]-4-methylpentanal (PubChem CID 91429644) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is 2-[[6-(2-chlorophenyl)-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]-4-methylpentanal.
| Compound Name | 2-[[6-(2-chlorophenyl)-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]-4-methylpentanal |
|---|---|
| PubChem CID | 91429644 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-[[6-(2-chlorophenyl)-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]-4-methylpentanal |
| SMILES | CC(C)CC(C=O)Nc1ncc2cc(-c3ccccc3Cl)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C20H21ClN4O2/c1-12(2)8-14(11-26)23-20-22-10-13-9-16(15-6-4-5-7-17(15)21)19(27)25(3)18(13)24-20/h4-7,9-12,14H,8H2,1-3H3,(H,22,23,24) |
| InChIKey | XYZYWUFXUQDITE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|