C24H26Cl2N4O2 — CID 142923567
6-(2,6-dichlorophenyl)-2-(4-hydroxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one;ethane (PubChem CID 142923567) has the molecular formula C24H26Cl2N4O2 and a molecular weight of 473.40 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-2-(4-hydroxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one;ethane.
| Compound Name | 6-(2,6-dichlorophenyl)-2-(4-hydroxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one;ethane |
|---|---|
| PubChem CID | 142923567 |
| Molecular Formula | C24H26Cl2N4O2 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-(4-hydroxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one;ethane |
| SMILES | CC.CC.Cn1c(=O)c(-c2c(Cl)cccc2Cl)cc2cnc(Nc3ccc(O)cc3)nc21 |
| InChI | InChI=1S/C20H14Cl2N4O2.2C2H6/c1-26-18-11(9-14(19(26)28)17-15(21)3-2-4-16(17)22)10-23-20(25-18)24-12-5-7-13(27)8-6-12;2*1-2/h2-10,27H,1H3,(H,23,24,25);2*1-2H3 |
| InChIKey | ZTWUSGWHZQCJRY-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|