C26H24Cl2N4O7 — CID 46186883
6-(2,6-dichlorophenyl)-8-methyl-2-[4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 46186883) has the molecular formula C26H24Cl2N4O7 and a molecular weight of 575.41 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-8-methyl-2-[4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2,6-dichlorophenyl)-8-methyl-2-[4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 46186883 |
| Molecular Formula | C26H24Cl2N4O7 |
| Molecular Weight | 575.41 g/mol |
| Exact Mass | 574.10 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-8-methyl-2-[4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cn1c(=O)c(-c2c(Cl)cccc2Cl)cc2cnc(Nc3ccc(O[C@@H]4O[C@H](CO)[C@H](O)[C@H](O)[C@H]4O)cc3)nc21 |
| InChI | InChI=1S/C26H24Cl2N4O7/c1-32-23-12(9-15(24(32)37)19-16(27)3-2-4-17(19)28)10-29-26(31-23)30-13-5-7-14(8-6-13)38-25-22(36)21(35)20(34)18(11-33)39-25/h2-10,18,20-22,25,33-36H,11H2,1H3,(H,29,30,31)/t18-,20+,21+,22-,25-/m1/s1 |
| InChIKey | APPAUNZXIPSWAS-XCXOWRKTSA-N |
| XLogP | 2.22 |
| TPSA | 159.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |