C27H35N11O — CID 155561998
5-cyclopentyl-7-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]tetrazolo[1,5-f]pteridin-4-one (PubChem CID 155561998) has the molecular formula C27H35N11O and a molecular weight of 529.65 g/mol. Its IUPAC name is 5-cyclopentyl-7-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]tetrazolo[1,5-f]pteridin-4-one.
| Compound Name | 5-cyclopentyl-7-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]tetrazolo[1,5-f]pteridin-4-one |
|---|---|
| PubChem CID | 155561998 |
| Molecular Formula | C27H35N11O |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | 5-cyclopentyl-7-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]tetrazolo[1,5-f]pteridin-4-one |
| SMILES | CN1CCN(C2CCN(c3ccc(Nc4ncc5c(n4)n(C4CCCC4)c(=O)c4nnnn45)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H35N11O/c1-34-14-16-36(17-15-34)21-10-12-35(13-11-21)20-8-6-19(7-9-20)29-27-28-18-23-24(30-27)37(22-4-2-3-5-22)26(39)25-31-32-33-38(23)25/h6-9,18,21-22H,2-5,10-17H2,1H3,(H,28,29,30) |
| InChIKey | ATRUVYVWTLZGGQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 112.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|