C23H28N10O2 — CID 155525072
5-cyclopentyl-7-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]tetrazolo[1,5-f]pteridin-4-one (PubChem CID 155525072) has the molecular formula C23H28N10O2 and a molecular weight of 476.55 g/mol. Its IUPAC name is 5-cyclopentyl-7-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]tetrazolo[1,5-f]pteridin-4-one.
| Compound Name | 5-cyclopentyl-7-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]tetrazolo[1,5-f]pteridin-4-one |
|---|---|
| PubChem CID | 155525072 |
| Molecular Formula | C23H28N10O2 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 5-cyclopentyl-7-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]tetrazolo[1,5-f]pteridin-4-one |
| SMILES | O=c1c2nnnn2c2cnc(Nc3ccc(N4CCN(CCO)CC4)cc3)nc2n1C1CCCC1 |
| InChI | InChI=1S/C23H28N10O2/c34-14-13-30-9-11-31(12-10-30)17-7-5-16(6-8-17)25-23-24-15-19-20(26-23)32(18-3-1-2-4-18)22(35)21-27-28-29-33(19)21/h5-8,15,18,34H,1-4,9-14H2,(H,24,25,26) |
| InChIKey | AUFJNMYRUCPXNI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|