About 1-cyclopentyl-7-[4-(3-hydroxypiperidin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one
1-cyclopentyl-7-[4-(3-hydroxypiperidin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 68860000) has the molecular formula C22H26N6O2
and a molecular weight of 406.49 g/mol. Its IUPAC name is 1-cyclopentyl-7-[4-(3-hydroxypiperidin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one.
Molecular Properties
| Compound Name | 1-cyclopentyl-7-[4-(3-hydroxypiperidin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one |
| PubChem CID | 68860000 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 1-cyclopentyl-7-[4-(3-hydroxypiperidin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | O=c1ncc2cnc(Nc3ccc(N4CCCC(O)C4)cc3)nc2n1C1CCCC1 |
| InChI | InChI=1S/C22H26N6O2/c29-19-6-3-11-27(14-19)17-9-7-16(8-10-17)25-21-23-12-15-13-24-22(30)28(20(15)26-21)18-4-1-2-5-18/h7-10,12-13,18-19,29H,1-6,11,14H2,(H,23,25,26) |
| InChIKey | LZVWCNCVLGWJKG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentyl-7-[4-(3-hydroxypiperidin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-7-[4-(3-hydroxypiperidin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one?
The IUPAC name of 1-cyclopentyl-7-[4-(3-hydroxypiperidin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one (CID 68860000) is 1-cyclopentyl-7-[4-(3-hydroxypiperidin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one.
What is the SMILES notation for 1-cyclopentyl-7-[4-(3-hydroxypiperidin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one?
The canonical SMILES for 1-cyclopentyl-7-[4-(3-hydroxypiperidin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one is O=c1ncc2cnc(Nc3ccc(N4CCCC(O)C4)cc3)nc2n1C1CCCC1.
What is the InChIKey of 1-cyclopentyl-7-[4-(3-hydroxypiperidin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one?
The InChIKey is LZVWCNCVLGWJKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N6O2/c29-19-6-3-11-27(14-19)17-9-7-16(8-10-17)25-21-23-12-15-13-24-22(30)28(20(15)26-21)18-4-1-2-5-18/h7-10,12-13,18-19,29H,1-6,11,14H2,(H,23,25,26).
What are the key properties of 1-cyclopentyl-7-[4-(3-hydroxypiperidin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one?
1-cyclopentyl-7-[4-(3-hydroxypiperidin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one has a molecular weight of 406.49 g/mol, XLogP of 3.01, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-7-[4-(3-hydroxypiperidin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one is sourced from PubChem (CID 68860000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).