C28H36N6O2 — CID 164813630
8-cyclopentyl-2-[4-(3,5-dimethylpiperazin-1-yl)anilino]-6-(2-methylpropanoyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 164813630) has the molecular formula C28H36N6O2 and a molecular weight of 488.64 g/mol. Its IUPAC name is 8-cyclopentyl-2-[4-(3,5-dimethylpiperazin-1-yl)anilino]-6-(2-methylpropanoyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-cyclopentyl-2-[4-(3,5-dimethylpiperazin-1-yl)anilino]-6-(2-methylpropanoyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 164813630 |
| Molecular Formula | C28H36N6O2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 8-cyclopentyl-2-[4-(3,5-dimethylpiperazin-1-yl)anilino]-6-(2-methylpropanoyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC1CN(c2ccc(Nc3ncc4cc(C(=O)C(C)C)c(=O)n(C5CCCC5)c4n3)cc2)CC(C)N1 |
| InChI | InChI=1S/C28H36N6O2/c1-17(2)25(35)24-13-20-14-29-28(32-26(20)34(27(24)36)23-7-5-6-8-23)31-21-9-11-22(12-10-21)33-15-18(3)30-19(4)16-33/h9-14,17-19,23,30H,5-8,15-16H2,1-4H3,(H,29,31,32) |
| InChIKey | RBIJWCDPBYDBIU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|