C26H32N8O3 — CID 122474947
2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-8-(1-prop-2-enoylpiperidin-3-yl)pyrimido[4,5-d]pyrimidin-5-one (PubChem CID 122474947) has the molecular formula C26H32N8O3 and a molecular weight of 504.60 g/mol. Its IUPAC name is 2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-8-(1-prop-2-enoylpiperidin-3-yl)pyrimido[4,5-d]pyrimidin-5-one.
| Compound Name | 2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-8-(1-prop-2-enoylpiperidin-3-yl)pyrimido[4,5-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 122474947 |
| Molecular Formula | C26H32N8O3 |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-8-(1-prop-2-enoylpiperidin-3-yl)pyrimido[4,5-d]pyrimidin-5-one |
| SMILES | C=CC(=O)N1CCCC(n2cnc(=O)c3cnc(Nc4ccc(N5CCN(CCO)CC5)cc4)nc32)C1 |
| InChI | InChI=1S/C26H32N8O3/c1-2-23(36)33-9-3-4-21(17-33)34-18-28-25(37)22-16-27-26(30-24(22)34)29-19-5-7-20(8-6-19)32-12-10-31(11-13-32)14-15-35/h2,5-8,16,18,21,35H,1,3-4,9-15,17H2,(H,27,29,30) |
| InChIKey | ZMIUTMUYQGUUCK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|