C24H28F2N8O — CID 122474652
1-[3-[2-[2,3-difluoro-4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 122474652) has the molecular formula C24H28F2N8O and a molecular weight of 482.54 g/mol. Its IUPAC name is 1-[3-[2-[2,3-difluoro-4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[2-[2,3-difluoro-4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122474652 |
| Molecular Formula | C24H28F2N8O |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 1-[3-[2-[2,3-difluoro-4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(n2cnc3cnc(Nc4ccc(N5CCN(C)CC5)c(F)c4F)nc32)C1 |
| InChI | InChI=1S/C24H28F2N8O/c1-3-20(35)33-8-4-5-16(14-33)34-15-28-18-13-27-24(30-23(18)34)29-17-6-7-19(22(26)21(17)25)32-11-9-31(2)10-12-32/h3,6-7,13,15-16H,1,4-5,8-12,14H2,2H3,(H,27,29,30) |
| InChIKey | GHPKEVSSLZMPSS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|